About (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid
(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 10855606) has the molecular formula C6H10O4
and a molecular weight of 146.14 g/mol. Its IUPAC name is (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
Molecular Properties
| Compound Name | (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| PubChem CID | 10855606 |
| Molecular Formula | C6H10O4 |
| Molecular Weight | 146.14 g/mol |
| Exact Mass | 146.06 |
| IUPAC Name | (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | CC1(C)OC[C@H](C(=O)O)O1 |
| InChI | InChI=1S/C6H10O4/c1-6(2)9-3-4(10-6)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4-/m1/s1 |
| InChIKey | OZPFVBLDYBXHAF-SCSAIBSYSA-N |
| XLogP | 0.22 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.14 |
| LogP ≤ 5 | 0.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The IUPAC name of (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (CID 10855606) is (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
What is the SMILES notation for (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The canonical SMILES for (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid is CC1(C)OC[C@H](C(=O)O)O1.
What is the InChIKey of (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
The InChIKey is OZPFVBLDYBXHAF-SCSAIBSYSA-N. The full InChI is InChI=1S/C6H10O4/c1-6(2)9-3-4(10-6)5(7)8/h4H,3H2,1-2H3,(H,7,8)/t4-/m1/s1.
What are the key properties of (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid?
(4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid has a molecular weight of 146.14 g/mol, XLogP of 0.22, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (4R)-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid is sourced from PubChem (CID 10855606), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).