About N-tert-butyl-2,2-dimethylpent-4-en-1-imine
N-tert-butyl-2,2-dimethylpent-4-en-1-imine (PubChem CID 10855875) has the molecular formula C11H21N
and a molecular weight of 167.30 g/mol. Its IUPAC name is N-tert-butyl-2,2-dimethylpent-4-en-1-imine.
Molecular Properties
| Compound Name | N-tert-butyl-2,2-dimethylpent-4-en-1-imine |
| PubChem CID | 10855875 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | N-tert-butyl-2,2-dimethylpent-4-en-1-imine |
| SMILES | C=CCC(C)(C)/C=N/C(C)(C)C |
| InChI | InChI=1S/C11H21N/c1-7-8-11(5,6)9-12-10(2,3)4/h7,9H,1,8H2,2-6H3/b12-9+ |
| InChIKey | NBIHPISJSSXWAS-FMIVXFBMSA-N |
| XLogP | 3.46 |
| TPSA | 12.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze N-tert-butyl-2,2-dimethylpent-4-en-1-imine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-tert-butyl-2,2-dimethylpent-4-en-1-imine?
The IUPAC name of N-tert-butyl-2,2-dimethylpent-4-en-1-imine (CID 10855875) is N-tert-butyl-2,2-dimethylpent-4-en-1-imine.
What is the SMILES notation for N-tert-butyl-2,2-dimethylpent-4-en-1-imine?
The canonical SMILES for N-tert-butyl-2,2-dimethylpent-4-en-1-imine is C=CCC(C)(C)/C=N/C(C)(C)C.
What is the InChIKey of N-tert-butyl-2,2-dimethylpent-4-en-1-imine?
The InChIKey is NBIHPISJSSXWAS-FMIVXFBMSA-N. The full InChI is InChI=1S/C11H21N/c1-7-8-11(5,6)9-12-10(2,3)4/h7,9H,1,8H2,2-6H3/b12-9+.
What are the key properties of N-tert-butyl-2,2-dimethylpent-4-en-1-imine?
N-tert-butyl-2,2-dimethylpent-4-en-1-imine has a molecular weight of 167.30 g/mol, XLogP of 3.46, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for N-tert-butyl-2,2-dimethylpent-4-en-1-imine is sourced from PubChem (CID 10855875), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).