About 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one
3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one (PubChem CID 10855890) has the molecular formula C10H16O2
and a molecular weight of 168.24 g/mol. Its IUPAC name is 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one.
Molecular Properties
| Compound Name | 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one |
| PubChem CID | 10855890 |
| Molecular Formula | C10H16O2 |
| Molecular Weight | 168.24 g/mol |
| Exact Mass | 168.12 |
| IUPAC Name | 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one |
| SMILES | COC1=C(C)C(=O)C(C)(C)CC1 |
| InChI | InChI=1S/C10H16O2/c1-7-8(12-4)5-6-10(2,3)9(7)11/h5-6H2,1-4H3 |
| InChIKey | PZLWKWMMAVNBTM-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.24 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one?
The IUPAC name of 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one (CID 10855890) is 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one.
What is the SMILES notation for 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one?
The canonical SMILES for 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one is COC1=C(C)C(=O)C(C)(C)CC1.
What is the InChIKey of 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one?
The InChIKey is PZLWKWMMAVNBTM-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2/c1-7-8(12-4)5-6-10(2,3)9(7)11/h5-6H2,1-4H3.
What are the key properties of 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one?
3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one has a molecular weight of 168.24 g/mol, XLogP of 2.30, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-methoxy-2,6,6-trimethylcyclohex-2-en-1-one is sourced from PubChem (CID 10855890), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).