C11H10O2 — CID 10855984
4-methylspiro[4.5]deca-3,6,9-triene-2,8-dione (PubChem CID 10855984) has the molecular formula C11H10O2 and a molecular weight of 174.20 g/mol. Its IUPAC name is 4-methylspiro[4.5]deca-3,6,9-triene-2,8-dione.
| Compound Name | 4-methylspiro[4.5]deca-3,6,9-triene-2,8-dione |
|---|---|
| PubChem CID | 10855984 |
| Molecular Formula | C11H10O2 |
| Molecular Weight | 174.20 g/mol |
| Exact Mass | 174.07 |
| IUPAC Name | 4-methylspiro[4.5]deca-3,6,9-triene-2,8-dione |
| SMILES | CC1=CC(=O)CC12C=CC(=O)C=C2 |
| InChI | InChI=1S/C11H10O2/c1-8-6-10(13)7-11(8)4-2-9(12)3-5-11/h2-6H,7H2,1H3 |
| InChIKey | RVNTXUDDIXEBMJ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 174.20 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |