About 2-phenyltriazole-4,5-diamine
2-phenyltriazole-4,5-diamine (PubChem CID 10856000) has the molecular formula C8H9N5
and a molecular weight of 175.20 g/mol. Its IUPAC name is 2-phenyltriazole-4,5-diamine.
Molecular Properties
| Compound Name | 2-phenyltriazole-4,5-diamine |
| PubChem CID | 10856000 |
| Molecular Formula | C8H9N5 |
| Molecular Weight | 175.20 g/mol |
| Exact Mass | 175.09 |
| IUPAC Name | 2-phenyltriazole-4,5-diamine |
| SMILES | Nc1nn(-c2ccccc2)nc1N |
| InChI | InChI=1S/C8H9N5/c9-7-8(10)12-13(11-7)6-4-2-1-3-5-6/h1-5H,(H2,9,11)(H2,10,12) |
| InChIKey | MEKVTRJBRWQWTA-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 82.75 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 175.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Analyze 2-phenyltriazole-4,5-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-phenyltriazole-4,5-diamine?
The IUPAC name of 2-phenyltriazole-4,5-diamine (CID 10856000) is 2-phenyltriazole-4,5-diamine.
What is the SMILES notation for 2-phenyltriazole-4,5-diamine?
The canonical SMILES for 2-phenyltriazole-4,5-diamine is Nc1nn(-c2ccccc2)nc1N.
What is the InChIKey of 2-phenyltriazole-4,5-diamine?
The InChIKey is MEKVTRJBRWQWTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9N5/c9-7-8(10)12-13(11-7)6-4-2-1-3-5-6/h1-5H,(H2,9,11)(H2,10,12).
What are the key properties of 2-phenyltriazole-4,5-diamine?
2-phenyltriazole-4,5-diamine has a molecular weight of 175.20 g/mol, XLogP of 0.43, 1 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for 2-phenyltriazole-4,5-diamine is sourced from PubChem (CID 10856000), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).