About 2,5-bis(but-3-enyl)furan
2,5-bis(but-3-enyl)furan (PubChem CID 10856026) has the molecular formula C12H16O
and a molecular weight of 176.26 g/mol. Its IUPAC name is 2,5-bis(but-3-enyl)furan.
Molecular Properties
| Compound Name | 2,5-bis(but-3-enyl)furan |
| PubChem CID | 10856026 |
| Molecular Formula | C12H16O |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.12 |
| IUPAC Name | 2,5-bis(but-3-enyl)furan |
| SMILES | C=CCCc1ccc(CCC=C)o1 |
| InChI | InChI=1S/C12H16O/c1-3-5-7-11-9-10-12(13-11)8-6-4-2/h3-4,9-10H,1-2,5-8H2 |
| InChIKey | HVYPJAHURQYWSP-UHFFFAOYSA-N |
| XLogP | 3.52 |
| TPSA | 13.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 3.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze 2,5-bis(but-3-enyl)furan with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,5-bis(but-3-enyl)furan?
The IUPAC name of 2,5-bis(but-3-enyl)furan (CID 10856026) is 2,5-bis(but-3-enyl)furan.
What is the SMILES notation for 2,5-bis(but-3-enyl)furan?
The canonical SMILES for 2,5-bis(but-3-enyl)furan is C=CCCc1ccc(CCC=C)o1.
What is the InChIKey of 2,5-bis(but-3-enyl)furan?
The InChIKey is HVYPJAHURQYWSP-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H16O/c1-3-5-7-11-9-10-12(13-11)8-6-4-2/h3-4,9-10H,1-2,5-8H2.
What are the key properties of 2,5-bis(but-3-enyl)furan?
2,5-bis(but-3-enyl)furan has a molecular weight of 176.26 g/mol, XLogP of 3.52, 6 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2,5-bis(but-3-enyl)furan is sourced from PubChem (CID 10856026), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).