C10H13NO2 — CID 10856057
(2S,3S,4S)-2-phenylpyrrolidine-3,4-diol (PubChem CID 10856057) has the molecular formula C10H13NO2 and a molecular weight of 179.22 g/mol. Its IUPAC name is (2S,3S,4S)-2-phenylpyrrolidine-3,4-diol.
| Compound Name | (2S,3S,4S)-2-phenylpyrrolidine-3,4-diol |
|---|---|
| PubChem CID | 10856057 |
| Molecular Formula | C10H13NO2 |
| Molecular Weight | 179.22 g/mol |
| Exact Mass | 179.09 |
| IUPAC Name | (2S,3S,4S)-2-phenylpyrrolidine-3,4-diol |
| SMILES | O[C@@H]1[C@@H](O)CN[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H13NO2/c12-8-6-11-9(10(8)13)7-4-2-1-3-5-7/h1-5,8-13H,6H2/t8-,9-,10+/m0/s1 |
| InChIKey | ZYKVHGYTSPUHNA-LPEHRKFASA-N |
| XLogP | 0.05 |
| TPSA | 52.49 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.22 |
| LogP ≤ 5 | 0.05 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |