C11H17NO — CID 10856064
1,4-dimethyl-3,4,5,6,7,8-hexahydroquinolin-2-one (PubChem CID 10856064) has the molecular formula C11H17NO and a molecular weight of 179.26 g/mol. Its IUPAC name is 1,4-dimethyl-3,4,5,6,7,8-hexahydroquinolin-2-one.
| Compound Name | 1,4-dimethyl-3,4,5,6,7,8-hexahydroquinolin-2-one |
|---|---|
| PubChem CID | 10856064 |
| Molecular Formula | C11H17NO |
| Molecular Weight | 179.26 g/mol |
| Exact Mass | 179.13 |
| IUPAC Name | 1,4-dimethyl-3,4,5,6,7,8-hexahydroquinolin-2-one |
| SMILES | CC1CC(=O)N(C)C2=C1CCCC2 |
| InChI | InChI=1S/C11H17NO/c1-8-7-11(13)12(2)10-6-4-3-5-9(8)10/h8H,3-7H2,1-2H3 |
| InChIKey | ILHGMJUYSMPNAH-UHFFFAOYSA-N |
| XLogP | 2.31 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.26 |
| LogP ≤ 5 | 2.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |