C10H12O3 — CID 10856073
(1'R,5'R)-spiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-3'-one (PubChem CID 10856073) has the molecular formula C10H12O3 and a molecular weight of 180.20 g/mol. Its IUPAC name is (1'R,5'R)-spiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-3'-one.
| Compound Name | (1'R,5'R)-spiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-3'-one |
|---|---|
| PubChem CID | 10856073 |
| Molecular Formula | C10H12O3 |
| Molecular Weight | 180.20 g/mol |
| Exact Mass | 180.08 |
| IUPAC Name | (1'R,5'R)-spiro[1,3-dioxolane-2,2'-bicyclo[3.2.1]oct-6-ene]-3'-one |
| SMILES | O=C1C[C@@H]2C=C[C@@H](C2)C12OCCO2 |
| InChI | InChI=1S/C10H12O3/c11-9-6-7-1-2-8(5-7)10(9)12-3-4-13-10/h1-2,7-8H,3-6H2/t7-,8+/m1/s1 |
| InChIKey | WPXHKDIOLBGDDK-SFYZADRCSA-N |
| XLogP | 0.89 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.20 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|