C11H18O2 — CID 10856130
2-(1-hydroxy-3-methylbutyl)cyclohex-2-en-1-one (PubChem CID 10856130) has the molecular formula C11H18O2 and a molecular weight of 182.26 g/mol. Its IUPAC name is 2-(1-hydroxy-3-methylbutyl)cyclohex-2-en-1-one.
| Compound Name | 2-(1-hydroxy-3-methylbutyl)cyclohex-2-en-1-one |
|---|---|
| PubChem CID | 10856130 |
| Molecular Formula | C11H18O2 |
| Molecular Weight | 182.26 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 2-(1-hydroxy-3-methylbutyl)cyclohex-2-en-1-one |
| SMILES | CC(C)CC(O)C1=CCCCC1=O |
| InChI | InChI=1S/C11H18O2/c1-8(2)7-11(13)9-5-3-4-6-10(9)12/h5,8,11,13H,3-4,6-7H2,1-2H3 |
| InChIKey | OYJICWGXDDIEBE-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 182.26 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |