C16H25N3O2S — CID 108561438
N,N-diethyl-4-[(2-thiophen-2-ylacetyl)amino]piperidine-1-carboxamide (PubChem CID 108561438) has the molecular formula C16H25N3O2S and a molecular weight of 323.46 g/mol. Its IUPAC name is N,N-diethyl-4-[(2-thiophen-2-ylacetyl)amino]piperidine-1-carboxamide.
| Compound Name | N,N-diethyl-4-[(2-thiophen-2-ylacetyl)amino]piperidine-1-carboxamide |
|---|---|
| PubChem CID | 108561438 |
| Molecular Formula | C16H25N3O2S |
| Molecular Weight | 323.46 g/mol |
| Exact Mass | 323.17 |
| IUPAC Name | N,N-diethyl-4-[(2-thiophen-2-ylacetyl)amino]piperidine-1-carboxamide |
| SMILES | CCN(CC)C(=O)N1CCC(NC(=O)Cc2cccs2)CC1 |
| InChI | InChI=1S/C16H25N3O2S/c1-3-18(4-2)16(21)19-9-7-13(8-10-19)17-15(20)12-14-6-5-11-22-14/h5-6,11,13H,3-4,7-10,12H2,1-2H3,(H,17,20) |
| InChIKey | PDULJPSDCRMWAM-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.46 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |