C10H20O3 — CID 10856240
(3R,6S)-2,6-dimethyloct-7-ene-2,3,6-triol (PubChem CID 10856240) has the molecular formula C10H20O3 and a molecular weight of 188.27 g/mol. Its IUPAC name is (3R,6S)-2,6-dimethyloct-7-ene-2,3,6-triol.
| Compound Name | (3R,6S)-2,6-dimethyloct-7-ene-2,3,6-triol |
|---|---|
| PubChem CID | 10856240 |
| Molecular Formula | C10H20O3 |
| Molecular Weight | 188.27 g/mol |
| Exact Mass | 188.14 |
| IUPAC Name | (3R,6S)-2,6-dimethyloct-7-ene-2,3,6-triol |
| SMILES | C=C[C@@](C)(O)CC[C@@H](O)C(C)(C)O |
| InChI | InChI=1S/C10H20O3/c1-5-10(4,13)7-6-8(11)9(2,3)12/h5,8,11-13H,1,6-7H2,2-4H3/t8-,10-/m1/s1 |
| InChIKey | CNYFGLAROLNGDG-PSASIEDQSA-N |
| XLogP | 0.84 |
| TPSA | 60.69 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.27 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|