C14H18ClN3O2 — CID 108562448
N-[1-(2-chloropropanoyl)piperidin-4-yl]pyridine-4-carboxamide (PubChem CID 108562448) has the molecular formula C14H18ClN3O2 and a molecular weight of 295.77 g/mol. Its IUPAC name is N-[1-(2-chloropropanoyl)piperidin-4-yl]pyridine-4-carboxamide.
| Compound Name | N-[1-(2-chloropropanoyl)piperidin-4-yl]pyridine-4-carboxamide |
|---|---|
| PubChem CID | 108562448 |
| Molecular Formula | C14H18ClN3O2 |
| Molecular Weight | 295.77 g/mol |
| Exact Mass | 295.11 |
| IUPAC Name | N-[1-(2-chloropropanoyl)piperidin-4-yl]pyridine-4-carboxamide |
| SMILES | CC(Cl)C(=O)N1CCC(NC(=O)c2ccncc2)CC1 |
| InChI | InChI=1S/C14H18ClN3O2/c1-10(15)14(20)18-8-4-12(5-9-18)17-13(19)11-2-6-16-7-3-11/h2-3,6-7,10,12H,4-5,8-9H2,1H3,(H,17,19) |
| InChIKey | QJTKEQYLNVGILV-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.77 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|