C17H23F3N2O3S — CID 108563028
N-(1-butylsulfonylpiperidin-4-yl)-4-(trifluoromethyl)benzamide (PubChem CID 108563028) has the molecular formula C17H23F3N2O3S and a molecular weight of 392.44 g/mol. Its IUPAC name is N-(1-butylsulfonylpiperidin-4-yl)-4-(trifluoromethyl)benzamide.
| Compound Name | N-(1-butylsulfonylpiperidin-4-yl)-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 108563028 |
| Molecular Formula | C17H23F3N2O3S |
| Molecular Weight | 392.44 g/mol |
| Exact Mass | 392.14 |
| IUPAC Name | N-(1-butylsulfonylpiperidin-4-yl)-4-(trifluoromethyl)benzamide |
| SMILES | CCCCS(=O)(=O)N1CCC(NC(=O)c2ccc(C(F)(F)F)cc2)CC1 |
| InChI | InChI=1S/C17H23F3N2O3S/c1-2-3-12-26(24,25)22-10-8-15(9-11-22)21-16(23)13-4-6-14(7-5-13)17(18,19)20/h4-7,15H,2-3,8-12H2,1H3,(H,21,23) |
| InChIKey | QTNWGHJLWZAYNE-UHFFFAOYSA-N |
| XLogP | 3.03 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.44 |
| LogP ≤ 5 | 3.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |