C18H25N3O3S — CID 108563235
4-tert-butyl-N-[1-(2-cyanoacetyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 108563235) has the molecular formula C18H25N3O3S and a molecular weight of 363.48 g/mol. Its IUPAC name is 4-tert-butyl-N-[1-(2-cyanoacetyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-tert-butyl-N-[1-(2-cyanoacetyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108563235 |
| Molecular Formula | C18H25N3O3S |
| Molecular Weight | 363.48 g/mol |
| Exact Mass | 363.16 |
| IUPAC Name | 4-tert-butyl-N-[1-(2-cyanoacetyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | CC(C)(C)c1ccc(S(=O)(=O)NC2CCN(C(=O)CC#N)CC2)cc1 |
| InChI | InChI=1S/C18H25N3O3S/c1-18(2,3)14-4-6-16(7-5-14)25(23,24)20-15-9-12-21(13-10-15)17(22)8-11-19/h4-7,15,20H,8-10,12-13H2,1-3H3 |
| InChIKey | YRRIADLHJNEYFK-UHFFFAOYSA-N |
| XLogP | 2.17 |
| TPSA | 90.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.48 |
| LogP ≤ 5 | 2.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |