C10H2F4 — CID 10856433
1,2-diethynyl-3,4,5,6-tetrafluorobenzene (PubChem CID 10856433) has the molecular formula C10H2F4 and a molecular weight of 198.12 g/mol. Its IUPAC name is 1,2-diethynyl-3,4,5,6-tetrafluorobenzene.
| Compound Name | 1,2-diethynyl-3,4,5,6-tetrafluorobenzene |
|---|---|
| PubChem CID | 10856433 |
| Molecular Formula | C10H2F4 |
| Molecular Weight | 198.12 g/mol |
| Exact Mass | 198.01 |
| IUPAC Name | 1,2-diethynyl-3,4,5,6-tetrafluorobenzene |
| SMILES | C#Cc1c(F)c(F)c(F)c(F)c1C#C |
| InChI | InChI=1S/C10H2F4/c1-3-5-6(4-2)8(12)10(14)9(13)7(5)11/h1-2H |
| InChIKey | CSJUMDGEHNZLIE-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.12 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|