C24H28N2O4 — CID 108564948
(E)-N-[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]-3-phenylprop-2-enamide (PubChem CID 108564948) has the molecular formula C24H28N2O4 and a molecular weight of 408.50 g/mol. Its IUPAC name is (E)-N-[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]-3-phenylprop-2-enamide.
| Compound Name | (E)-N-[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]-3-phenylprop-2-enamide |
|---|---|
| PubChem CID | 108564948 |
| Molecular Formula | C24H28N2O4 |
| Molecular Weight | 408.50 g/mol |
| Exact Mass | 408.20 |
| IUPAC Name | (E)-N-[1-[2-(2-ethoxyphenoxy)acetyl]piperidin-4-yl]-3-phenylprop-2-enamide |
| SMILES | CCOc1ccccc1OCC(=O)N1CCC(NC(=O)/C=C/c2ccccc2)CC1 |
| InChI | InChI=1S/C24H28N2O4/c1-2-29-21-10-6-7-11-22(21)30-18-24(28)26-16-14-20(15-17-26)25-23(27)13-12-19-8-4-3-5-9-19/h3-13,20H,2,14-18H2,1H3,(H,25,27)/b13-12+ |
| InChIKey | GKQXJUNLXPMVKA-OUKQBFOZSA-N |
| XLogP | 3.28 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.50 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|