C11H20O3 — CID 10856499
3-[(4S,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal (PubChem CID 10856499) has the molecular formula C11H20O3 and a molecular weight of 200.28 g/mol. Its IUPAC name is 3-[(4S,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal.
| Compound Name | 3-[(4S,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal |
|---|---|
| PubChem CID | 10856499 |
| Molecular Formula | C11H20O3 |
| Molecular Weight | 200.28 g/mol |
| Exact Mass | 200.14 |
| IUPAC Name | 3-[(4S,5R)-4-ethyl-2,2,5-trimethyl-1,3-dioxolan-4-yl]propanal |
| SMILES | CC[C@@]1(CCC=O)OC(C)(C)O[C@@H]1C |
| InChI | InChI=1S/C11H20O3/c1-5-11(7-6-8-12)9(2)13-10(3,4)14-11/h8-9H,5-7H2,1-4H3/t9-,11+/m1/s1 |
| InChIKey | FLEQPPLHCIDYCM-KOLCDFICSA-N |
| XLogP | 2.29 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 200.28 |
| LogP ≤ 5 | 2.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|