About 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one
2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one (PubChem CID 10856526) has the molecular formula C11H11N3O
and a molecular weight of 201.23 g/mol. Its IUPAC name is 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one.
Molecular Properties
| Compound Name | 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one |
| PubChem CID | 10856526 |
| Molecular Formula | C11H11N3O |
| Molecular Weight | 201.23 g/mol |
| Exact Mass | 201.09 |
| IUPAC Name | 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one |
| SMILES | NC1=NC2(Cc3ccccc3C2)C(=O)N1 |
| InChI | InChI=1S/C11H11N3O/c12-10-13-9(15)11(14-10)5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2,(H3,12,13,14,15) |
| InChIKey | NEDXLKRYLOIJFU-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 67.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 201.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one?
The IUPAC name of 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one (CID 10856526) is 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one.
What is the SMILES notation for 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one?
The canonical SMILES for 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one is NC1=NC2(Cc3ccccc3C2)C(=O)N1.
What is the InChIKey of 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one?
The InChIKey is NEDXLKRYLOIJFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H11N3O/c12-10-13-9(15)11(14-10)5-7-3-1-2-4-8(7)6-11/h1-4H,5-6H2,(H3,12,13,14,15).
What are the key properties of 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one?
2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one has a molecular weight of 201.23 g/mol, XLogP of -0.03, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2'-aminospiro[1,3-dihydroindene-2,4'-1H-imidazole]-5'-one is sourced from PubChem (CID 10856526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).