C18H26N2O4 — CID 108566230
2-methylpropyl N-[1-(2-phenoxyacetyl)piperidin-4-yl]carbamate (PubChem CID 108566230) has the molecular formula C18H26N2O4 and a molecular weight of 334.42 g/mol. Its IUPAC name is 2-methylpropyl N-[1-(2-phenoxyacetyl)piperidin-4-yl]carbamate.
| Compound Name | 2-methylpropyl N-[1-(2-phenoxyacetyl)piperidin-4-yl]carbamate |
|---|---|
| PubChem CID | 108566230 |
| Molecular Formula | C18H26N2O4 |
| Molecular Weight | 334.42 g/mol |
| Exact Mass | 334.19 |
| IUPAC Name | 2-methylpropyl N-[1-(2-phenoxyacetyl)piperidin-4-yl]carbamate |
| SMILES | CC(C)COC(=O)NC1CCN(C(=O)COc2ccccc2)CC1 |
| InChI | InChI=1S/C18H26N2O4/c1-14(2)12-24-18(22)19-15-8-10-20(11-9-15)17(21)13-23-16-6-4-3-5-7-16/h3-7,14-15H,8-13H2,1-2H3,(H,19,22) |
| InChIKey | RVUKTIPPHYXATA-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 67.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.42 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |