C18H16F3N3O5S — CID 108566649
4-nitro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]benzenesulfonamide (PubChem CID 108566649) has the molecular formula C18H16F3N3O5S and a molecular weight of 443.40 g/mol. Its IUPAC name is 4-nitro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]benzenesulfonamide.
| Compound Name | 4-nitro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]benzenesulfonamide |
|---|---|
| PubChem CID | 108566649 |
| Molecular Formula | C18H16F3N3O5S |
| Molecular Weight | 443.40 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 4-nitro-N-[1-(2,3,4-trifluorobenzoyl)piperidin-4-yl]benzenesulfonamide |
| SMILES | O=C(c1ccc(F)c(F)c1F)N1CCC(NS(=O)(=O)c2ccc([N+](=O)[O-])cc2)CC1 |
| InChI | InChI=1S/C18H16F3N3O5S/c19-15-6-5-14(16(20)17(15)21)18(25)23-9-7-11(8-10-23)22-30(28,29)13-3-1-12(2-4-13)24(26)27/h1-6,11,22H,7-10H2 |
| InChIKey | QIGWKIKHBTYDJE-UHFFFAOYSA-N |
| XLogP | 2.60 |
| TPSA | 109.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.40 |
| LogP ≤ 5 | 2.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|