C12H16OS — CID 10856707
4,4-dimethyl-2-phenylthiolan-3-ol (PubChem CID 10856707) has the molecular formula C12H16OS and a molecular weight of 208.33 g/mol. Its IUPAC name is 4,4-dimethyl-2-phenylthiolan-3-ol.
| Compound Name | 4,4-dimethyl-2-phenylthiolan-3-ol |
|---|---|
| PubChem CID | 10856707 |
| Molecular Formula | C12H16OS |
| Molecular Weight | 208.33 g/mol |
| Exact Mass | 208.09 |
| IUPAC Name | 4,4-dimethyl-2-phenylthiolan-3-ol |
| SMILES | CC1(C)CSC(c2ccccc2)C1O |
| InChI | InChI=1S/C12H16OS/c1-12(2)8-14-10(11(12)13)9-6-4-3-5-7-9/h3-7,10-11,13H,8H2,1-2H3 |
| InChIKey | DOOVQVYQFFJURK-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.33 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |