C12H18OS — CID 10856756
3-(2-ethylsulfanylethyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-one (PubChem CID 10856756) has the molecular formula C12H18OS and a molecular weight of 210.34 g/mol. Its IUPAC name is 3-(2-ethylsulfanylethyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-one.
| Compound Name | 3-(2-ethylsulfanylethyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
|---|---|
| PubChem CID | 10856756 |
| Molecular Formula | C12H18OS |
| Molecular Weight | 210.34 g/mol |
| Exact Mass | 210.11 |
| IUPAC Name | 3-(2-ethylsulfanylethyl)-4,5,6,6a-tetrahydro-1H-pentalen-2-one |
| SMILES | CCSCCC1=C2CCCC2CC1=O |
| InChI | InChI=1S/C12H18OS/c1-2-14-7-6-11-10-5-3-4-9(10)8-12(11)13/h9H,2-8H2,1H3 |
| InChIKey | FRDNKHXGGXEALH-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.34 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|