C14H16Cl2N2O3 — CID 108567688
2,2-dichloro-1-[4-(2-methoxybenzoyl)piperazin-1-yl]ethanone (PubChem CID 108567688) has the molecular formula C14H16Cl2N2O3 and a molecular weight of 331.20 g/mol. Its IUPAC name is 2,2-dichloro-1-[4-(2-methoxybenzoyl)piperazin-1-yl]ethanone.
| Compound Name | 2,2-dichloro-1-[4-(2-methoxybenzoyl)piperazin-1-yl]ethanone |
|---|---|
| PubChem CID | 108567688 |
| Molecular Formula | C14H16Cl2N2O3 |
| Molecular Weight | 331.20 g/mol |
| Exact Mass | 330.05 |
| IUPAC Name | 2,2-dichloro-1-[4-(2-methoxybenzoyl)piperazin-1-yl]ethanone |
| SMILES | COc1ccccc1C(=O)N1CCN(C(=O)C(Cl)Cl)CC1 |
| InChI | InChI=1S/C14H16Cl2N2O3/c1-21-11-5-3-2-4-10(11)13(19)17-6-8-18(9-7-17)14(20)12(15)16/h2-5,12H,6-9H2,1H3 |
| InChIKey | SOFROZFRVWYQFD-UHFFFAOYSA-N |
| XLogP | 1.78 |
| TPSA | 49.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.20 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|