C21H26N2O6S — CID 108567799
(2,6-dimethoxyphenyl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 108567799) has the molecular formula C21H26N2O6S and a molecular weight of 434.51 g/mol. Its IUPAC name is (2,6-dimethoxyphenyl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone.
| Compound Name | (2,6-dimethoxyphenyl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
|---|---|
| PubChem CID | 108567799 |
| Molecular Formula | C21H26N2O6S |
| Molecular Weight | 434.51 g/mol |
| Exact Mass | 434.15 |
| IUPAC Name | (2,6-dimethoxyphenyl)-[4-(4-ethoxyphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | CCOc1ccc(S(=O)(=O)N2CCN(C(=O)c3c(OC)cccc3OC)CC2)cc1 |
| InChI | InChI=1S/C21H26N2O6S/c1-4-29-16-8-10-17(11-9-16)30(25,26)23-14-12-22(13-15-23)21(24)20-18(27-2)6-5-7-19(20)28-3/h5-11H,4,12-15H2,1-3H3 |
| InChIKey | ZZZOYVDKXLAYBN-UHFFFAOYSA-N |
| XLogP | 2.25 |
| TPSA | 85.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.51 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |