C12H23NO2 — CID 10856827
methyl (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate (PubChem CID 10856827) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is methyl (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate.
| Compound Name | methyl (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate |
|---|---|
| PubChem CID | 10856827 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | methyl (2S)-2-(2,2-dimethylpropylideneamino)-4-methylpentanoate |
| SMILES | COC(=O)[C@H](CC(C)C)/N=C/C(C)(C)C |
| InChI | InChI=1S/C12H23NO2/c1-9(2)7-10(11(14)15-6)13-8-12(3,4)5/h8-10H,7H2,1-6H3/b13-8+/t10-/m0/s1 |
| InChIKey | RNJRKSLWUHVDKR-XNFYSYIQSA-N |
| XLogP | 2.69 |
| TPSA | 38.66 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|