C19H21N5O5S — CID 108568395
2-[2-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione (PubChem CID 108568395) has the molecular formula C19H21N5O5S and a molecular weight of 431.47 g/mol. Its IUPAC name is 2-[2-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione.
| Compound Name | 2-[2-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
|---|---|
| PubChem CID | 108568395 |
| Molecular Formula | C19H21N5O5S |
| Molecular Weight | 431.47 g/mol |
| Exact Mass | 431.13 |
| IUPAC Name | 2-[2-[4-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]piperazin-1-yl]-2-oxoethyl]isoindole-1,3-dione |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1CCN(C(=O)CN2C(=O)c3ccccc3C2=O)CC1 |
| InChI | InChI=1S/C19H21N5O5S/c1-12-17(13(2)21-20-12)30(28,29)23-9-7-22(8-10-23)16(25)11-24-18(26)14-5-3-4-6-15(14)19(24)27/h3-6H,7-11H2,1-2H3,(H,20,21) |
| InChIKey | UJGWENSRKANGRI-UHFFFAOYSA-N |
| XLogP | 0.16 |
| TPSA | 123.75 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.47 |
| LogP ≤ 5 | 0.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|