About Ferrocenyl methanol
Ferrocenyl methanol (PubChem CID 10856885) has the molecular formula C11H12FeO
and a molecular weight of 216.06 g/mol.
Molecular Properties
| Compound Name | Ferrocenyl methanol |
| PubChem CID | 10856885 |
| Molecular Formula | C11H12FeO |
| Molecular Weight | 216.06 g/mol |
| Exact Mass | 216.02 |
| IUPAC Name | — |
| SMILES | OCC1=CC=C[CH]1.[CH]1C=CC=C1.[Fe] |
| InChI | InChI=1S/C6H7O.C5H5.Fe/c7-5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4,7H,5H2;1-5H; |
| InChIKey | QETISSZVCNFQBN-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 216.06 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze Ferrocenyl methanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of Ferrocenyl methanol?
The IUPAC name of Ferrocenyl methanol (CID 10856885) is not available.
What is the SMILES notation for Ferrocenyl methanol?
The canonical SMILES for Ferrocenyl methanol is OCC1=CC=C[CH]1.[CH]1C=CC=C1.[Fe].
What is the InChIKey of Ferrocenyl methanol?
The InChIKey is QETISSZVCNFQBN-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7O.C5H5.Fe/c7-5-6-3-1-2-4-6;1-2-4-5-3-1;/h1-4,7H,5H2;1-5H;.
What are the key properties of Ferrocenyl methanol?
Ferrocenyl methanol has a molecular weight of 216.06 g/mol, XLogP of 1.99, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for Ferrocenyl methanol is sourced from PubChem (CID 10856885), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).