C14H19NO — CID 10856930
(3R,4S)-2,4-dimethyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine (PubChem CID 10856930) has the molecular formula C14H19NO and a molecular weight of 217.31 g/mol. Its IUPAC name is (3R,4S)-2,4-dimethyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine.
| Compound Name | (3R,4S)-2,4-dimethyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine |
|---|---|
| PubChem CID | 10856930 |
| Molecular Formula | C14H19NO |
| Molecular Weight | 217.31 g/mol |
| Exact Mass | 217.15 |
| IUPAC Name | (3R,4S)-2,4-dimethyl-3-phenyl-5-prop-2-enyl-1,2-oxazolidine |
| SMILES | C=CCC1ON(C)[C@@H](c2ccccc2)[C@@H]1C |
| InChI | InChI=1S/C14H19NO/c1-4-8-13-11(2)14(15(3)16-13)12-9-6-5-7-10-12/h4-7,9-11,13-14H,1,8H2,2-3H3/t11-,13?,14-/m1/s1 |
| InChIKey | DATVIHTYSKOVFI-AODWJNRKSA-N |
| XLogP | 3.19 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.31 |
| LogP ≤ 5 | 3.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|