About 5-phenyl-8,9-dihydro-7H-benzo[7]annulene
5-phenyl-8,9-dihydro-7H-benzo[7]annulene (PubChem CID 10857019) has the molecular formula C17H16
and a molecular weight of 220.32 g/mol. Its IUPAC name is 5-phenyl-8,9-dihydro-7H-benzo[7]annulene.
Molecular Properties
| Compound Name | 5-phenyl-8,9-dihydro-7H-benzo[7]annulene |
| PubChem CID | 10857019 |
| Molecular Formula | C17H16 |
| Molecular Weight | 220.32 g/mol |
| Exact Mass | 220.13 |
| IUPAC Name | 5-phenyl-8,9-dihydro-7H-benzo[7]annulene |
| SMILES | C1=C(c2ccccc2)c2ccccc2CCC1 |
| InChI | InChI=1S/C17H16/c1-2-8-14(9-3-1)16-12-6-4-10-15-11-5-7-13-17(15)16/h1-3,5,7-9,11-13H,4,6,10H2 |
| InChIKey | JXEOULHHABOQBV-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 220.32 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 5-phenyl-8,9-dihydro-7H-benzo[7]annulene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-phenyl-8,9-dihydro-7H-benzo[7]annulene?
The IUPAC name of 5-phenyl-8,9-dihydro-7H-benzo[7]annulene (CID 10857019) is 5-phenyl-8,9-dihydro-7H-benzo[7]annulene.
What is the SMILES notation for 5-phenyl-8,9-dihydro-7H-benzo[7]annulene?
The canonical SMILES for 5-phenyl-8,9-dihydro-7H-benzo[7]annulene is C1=C(c2ccccc2)c2ccccc2CCC1.
What is the InChIKey of 5-phenyl-8,9-dihydro-7H-benzo[7]annulene?
The InChIKey is JXEOULHHABOQBV-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H16/c1-2-8-14(9-3-1)16-12-6-4-10-15-11-5-7-13-17(15)16/h1-3,5,7-9,11-13H,4,6,10H2.
What are the key properties of 5-phenyl-8,9-dihydro-7H-benzo[7]annulene?
5-phenyl-8,9-dihydro-7H-benzo[7]annulene has a molecular weight of 220.32 g/mol, XLogP of 4.45, 1 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 5-phenyl-8,9-dihydro-7H-benzo[7]annulene is sourced from PubChem (CID 10857019), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).