C13H17ClN2O4 — CID 108571269
2-chloroethyl N-[2-[(3-methoxybenzoyl)amino]ethyl]carbamate (PubChem CID 108571269) has the molecular formula C13H17ClN2O4 and a molecular weight of 300.74 g/mol. Its IUPAC name is 2-chloroethyl N-[2-[(3-methoxybenzoyl)amino]ethyl]carbamate.
| Compound Name | 2-chloroethyl N-[2-[(3-methoxybenzoyl)amino]ethyl]carbamate |
|---|---|
| PubChem CID | 108571269 |
| Molecular Formula | C13H17ClN2O4 |
| Molecular Weight | 300.74 g/mol |
| Exact Mass | 300.09 |
| IUPAC Name | 2-chloroethyl N-[2-[(3-methoxybenzoyl)amino]ethyl]carbamate |
| SMILES | COc1cccc(C(=O)NCCNC(=O)OCCCl)c1 |
| InChI | InChI=1S/C13H17ClN2O4/c1-19-11-4-2-3-10(9-11)12(17)15-6-7-16-13(18)20-8-5-14/h2-4,9H,5-8H2,1H3,(H,15,17)(H,16,18) |
| InChIKey | ZTIZGIKNPGUTJA-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.74 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|