C14H26O2 — CID 10857159
(3S,4S,5S,6R,7R,8R)-3,5,6,8-tetramethyldeca-1,9-diene-4,7-diol (PubChem CID 10857159) has the molecular formula C14H26O2 and a molecular weight of 226.36 g/mol. Its IUPAC name is (3S,4S,5S,6R,7R,8R)-3,5,6,8-tetramethyldeca-1,9-diene-4,7-diol.
| Compound Name | (3S,4S,5S,6R,7R,8R)-3,5,6,8-tetramethyldeca-1,9-diene-4,7-diol |
|---|---|
| PubChem CID | 10857159 |
| Molecular Formula | C14H26O2 |
| Molecular Weight | 226.36 g/mol |
| Exact Mass | 226.19 |
| IUPAC Name | (3S,4S,5S,6R,7R,8R)-3,5,6,8-tetramethyldeca-1,9-diene-4,7-diol |
| SMILES | C=C[C@@H](C)[C@@H](O)[C@H](C)[C@H](C)[C@@H](O)[C@@H](C)C=C |
| InChI | InChI=1S/C14H26O2/c1-7-9(3)13(15)11(5)12(6)14(16)10(4)8-2/h7-16H,1-2H2,3-6H3/t9-,10+,11-,12+,13-,14+ |
| InChIKey | HRDHCTXCQGHHBF-LRRLDJKKSA-N |
| XLogP | 2.62 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.36 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|