About prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate
prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate (PubChem CID 108572412) has the molecular formula C14H23N3O4
and a molecular weight of 297.36 g/mol. Its IUPAC name is prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate.
Molecular Properties
| Compound Name | prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate |
| PubChem CID | 108572412 |
| Molecular Formula | C14H23N3O4 |
| Molecular Weight | 297.36 g/mol |
| Exact Mass | 297.17 |
| IUPAC Name | prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate |
| SMILES | C=CCOC(=O)NCCNC(=O)C1CC(=O)N(C(C)C)C1 |
| InChI | InChI=1S/C14H23N3O4/c1-4-7-21-14(20)16-6-5-15-13(19)11-8-12(18)17(9-11)10(2)3/h4,10-11H,1,5-9H2,2-3H3,(H,15,19)(H,16,20) |
| InChIKey | WJOYPNMQEZTAAU-UHFFFAOYSA-N |
| XLogP | 0.27 |
| TPSA | 87.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 297.36 |
| LogP ≤ 5 | 0.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate?
The IUPAC name of prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate (CID 108572412) is prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate.
What is the SMILES notation for prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate?
The canonical SMILES for prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate is C=CCOC(=O)NCCNC(=O)C1CC(=O)N(C(C)C)C1.
What is the InChIKey of prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate?
The InChIKey is WJOYPNMQEZTAAU-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H23N3O4/c1-4-7-21-14(20)16-6-5-15-13(19)11-8-12(18)17(9-11)10(2)3/h4,10-11H,1,5-9H2,2-3H3,(H,15,19)(H,16,20).
What are the key properties of prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate?
prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate has a molecular weight of 297.36 g/mol, XLogP of 0.27, 7 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for prop-2-enyl N-[2-[(5-oxo-1-propan-2-ylpyrrolidine-3-carbonyl)amino]ethyl]carbamate is sourced from PubChem (CID 108572412), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).