C19H20F2N2O3 — CID 108573126
N-[2-[[2-(4-ethoxyphenyl)acetyl]amino]ethyl]-2,4-difluorobenzamide (PubChem CID 108573126) has the molecular formula C19H20F2N2O3 and a molecular weight of 362.38 g/mol. Its IUPAC name is N-[2-[[2-(4-ethoxyphenyl)acetyl]amino]ethyl]-2,4-difluorobenzamide.
| Compound Name | N-[2-[[2-(4-ethoxyphenyl)acetyl]amino]ethyl]-2,4-difluorobenzamide |
|---|---|
| PubChem CID | 108573126 |
| Molecular Formula | C19H20F2N2O3 |
| Molecular Weight | 362.38 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | N-[2-[[2-(4-ethoxyphenyl)acetyl]amino]ethyl]-2,4-difluorobenzamide |
| SMILES | CCOc1ccc(CC(=O)NCCNC(=O)c2ccc(F)cc2F)cc1 |
| InChI | InChI=1S/C19H20F2N2O3/c1-2-26-15-6-3-13(4-7-15)11-18(24)22-9-10-23-19(25)16-8-5-14(20)12-17(16)21/h3-8,12H,2,9-11H2,1H3,(H,22,24)(H,23,25) |
| InChIKey | GOXZHWVUIYJILT-UHFFFAOYSA-N |
| XLogP | 2.45 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.38 |
| LogP ≤ 5 | 2.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|