2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid

C10H16O2S2 — CID 10857338

IUPAC2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid
SMILESC=CCCCC1(CC(=O)O)SCCS1
InChIInChI=1S/C10H16O2S2/c1-2-3-4-5-10(8-9(11)12)13-6-7-14-10/h2H,1,3-8H2,(H,11,12)
InChIKeyYTFYUBDAMAKZBP-UHFFFAOYSA-N
MW232.37 g/mol
LogP2.99
Rot. Bonds6

About 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid

2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid (PubChem CID 10857338) has the molecular formula C10H16O2S2 and a molecular weight of 232.37 g/mol. Its IUPAC name is 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid.

Molecular Properties

Compound Name2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid
PubChem CID10857338
Molecular FormulaC10H16O2S2
Molecular Weight232.37 g/mol
Exact Mass232.06
IUPAC Name2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid
SMILESC=CCCCC1(CC(=O)O)SCCS1
InChIInChI=1S/C10H16O2S2/c1-2-3-4-5-10(8-9(11)12)13-6-7-14-10/h2H,1,3-8H2,(H,11,12)
InChIKeyYTFYUBDAMAKZBP-UHFFFAOYSA-N
XLogP2.99
TPSA37.30 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds6
Heavy Atoms14
Complexity

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500232.37
LogP ≤ 52.99
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid?
The IUPAC name of 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid (CID 10857338) is 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid.
What is the SMILES notation for 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid?
The canonical SMILES for 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid is C=CCCCC1(CC(=O)O)SCCS1.
What is the InChIKey of 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid?
The InChIKey is YTFYUBDAMAKZBP-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H16O2S2/c1-2-3-4-5-10(8-9(11)12)13-6-7-14-10/h2H,1,3-8H2,(H,11,12).
What are the key properties of 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid?
2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid has a molecular weight of 232.37 g/mol, XLogP of 2.99, 6 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2-pent-4-enyl-1,3-dithiolan-2-yl)acetic acid is sourced from PubChem (CID 10857338), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).