C13H16Cl2N2O3 — CID 108573549
N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3-phenoxypropanamide (PubChem CID 108573549) has the molecular formula C13H16Cl2N2O3 and a molecular weight of 319.19 g/mol. Its IUPAC name is N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3-phenoxypropanamide.
| Compound Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3-phenoxypropanamide |
|---|---|
| PubChem CID | 108573549 |
| Molecular Formula | C13H16Cl2N2O3 |
| Molecular Weight | 319.19 g/mol |
| Exact Mass | 318.05 |
| IUPAC Name | N-[2-[(2,2-dichloroacetyl)amino]ethyl]-3-phenoxypropanamide |
| SMILES | O=C(CCOc1ccccc1)NCCNC(=O)C(Cl)Cl |
| InChI | InChI=1S/C13H16Cl2N2O3/c14-12(15)13(19)17-8-7-16-11(18)6-9-20-10-4-2-1-3-5-10/h1-5,12H,6-9H2,(H,16,18)(H,17,19) |
| InChIKey | UPXSJQFXKKZWQS-UHFFFAOYSA-N |
| XLogP | 1.49 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.19 |
| LogP ≤ 5 | 1.49 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|