C10H19O4P — CID 10857365
(1E,3E)-1-diethoxyphosphoryl-4-methoxy-2-methylbuta-1,3-diene (PubChem CID 10857365) has the molecular formula C10H19O4P and a molecular weight of 234.23 g/mol. Its IUPAC name is (1E,3E)-1-diethoxyphosphoryl-4-methoxy-2-methylbuta-1,3-diene.
| Compound Name | (1E,3E)-1-diethoxyphosphoryl-4-methoxy-2-methylbuta-1,3-diene |
|---|---|
| PubChem CID | 10857365 |
| Molecular Formula | C10H19O4P |
| Molecular Weight | 234.23 g/mol |
| Exact Mass | 234.10 |
| IUPAC Name | (1E,3E)-1-diethoxyphosphoryl-4-methoxy-2-methylbuta-1,3-diene |
| SMILES | CCOP(=O)(/C=C(C)/C=C/OC)OCC |
| InChI | InChI=1S/C10H19O4P/c1-5-13-15(11,14-6-2)9-10(3)7-8-12-4/h7-9H,5-6H2,1-4H3/b8-7+,10-9+ |
| InChIKey | KFWYAYJHPZXEKD-XBLVEGMJSA-N |
| XLogP | 3.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.23 |
| LogP ≤ 5 | 3.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|