C13H18O4 — CID 10857521
(1R,2R,4R)-8,8-dimethoxy-2,5-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carbaldehyde (PubChem CID 10857521) has the molecular formula C13H18O4 and a molecular weight of 238.28 g/mol. Its IUPAC name is (1R,2R,4R)-8,8-dimethoxy-2,5-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carbaldehyde.
| Compound Name | (1R,2R,4R)-8,8-dimethoxy-2,5-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
|---|---|
| PubChem CID | 10857521 |
| Molecular Formula | C13H18O4 |
| Molecular Weight | 238.28 g/mol |
| Exact Mass | 238.12 |
| IUPAC Name | (1R,2R,4R)-8,8-dimethoxy-2,5-dimethyl-7-oxobicyclo[2.2.2]oct-5-ene-2-carbaldehyde |
| SMILES | COC1(OC)C(=O)[C@@H]2C=C(C)[C@H]1C[C@@]2(C)C=O |
| InChI | InChI=1S/C13H18O4/c1-8-5-9-11(15)13(16-3,17-4)10(8)6-12(9,2)7-14/h5,7,9-10H,6H2,1-4H3/t9-,10+,12-/m0/s1 |
| InChIKey | UUHTVBSHYGQXJY-UMNHJUIQSA-N |
| XLogP | 1.35 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.28 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|