C12H14O3S — CID 10857526
[(1S,2R,4R,5S)-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol (PubChem CID 10857526) has the molecular formula C12H14O3S and a molecular weight of 238.31 g/mol. Its IUPAC name is [(1S,2R,4R,5S)-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol.
| Compound Name | [(1S,2R,4R,5S)-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
|---|---|
| PubChem CID | 10857526 |
| Molecular Formula | C12H14O3S |
| Molecular Weight | 238.31 g/mol |
| Exact Mass | 238.07 |
| IUPAC Name | [(1S,2R,4R,5S)-4-(4-methylphenyl)sulfanyl-3,6-dioxabicyclo[3.1.0]hexan-2-yl]methanol |
| SMILES | Cc1ccc(S[C@H]2O[C@H](CO)[C@@H]3O[C@@H]32)cc1 |
| InChI | InChI=1S/C12H14O3S/c1-7-2-4-8(5-3-7)16-12-11-10(15-11)9(6-13)14-12/h2-5,9-13H,6H2,1H3/t9-,10+,11+,12-/m1/s1 |
| InChIKey | WUQPBDOOBLGRBX-NOOOWODRSA-N |
| XLogP | 1.57 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 238.31 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|