C28H27NO6 — CID 108576127
(4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dimethylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108576127) has the molecular formula C28H27NO6 and a molecular weight of 473.53 g/mol. Its IUPAC name is (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dimethylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dimethylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108576127 |
| Molecular Formula | C28H27NO6 |
| Molecular Weight | 473.53 g/mol |
| Exact Mass | 473.18 |
| IUPAC Name | (4E)-4-[(2,6-dimethoxyphenyl)-hydroxymethylidene]-1-(2,3-dimethylphenyl)-5-(4-methoxyphenyl)pyrrolidine-2,3-dione |
| SMILES | COc1ccc(C2/C(=C(\O)c3c(OC)cccc3OC)C(=O)C(=O)N2c2cccc(C)c2C)cc1 |
| InChI | InChI=1S/C28H27NO6/c1-16-8-6-9-20(17(16)2)29-25(18-12-14-19(33-3)15-13-18)24(27(31)28(29)32)26(30)23-21(34-4)10-7-11-22(23)35-5/h6-15,25,30H,1-5H3/b26-24+ |
| InChIKey | DEOGFFYDYZOFBB-SHHOIMCASA-N |
| XLogP | 4.96 |
| TPSA | 85.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.53 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|