C12H19NO4 — CID 10857626
ethyl (3aR,4S,7aS)-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate (PubChem CID 10857626) has the molecular formula C12H19NO4 and a molecular weight of 241.29 g/mol. Its IUPAC name is ethyl (3aR,4S,7aS)-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate.
| Compound Name | ethyl (3aR,4S,7aS)-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate |
|---|---|
| PubChem CID | 10857626 |
| Molecular Formula | C12H19NO4 |
| Molecular Weight | 241.29 g/mol |
| Exact Mass | 241.13 |
| IUPAC Name | ethyl (3aR,4S,7aS)-4-hydroxy-2,2-dimethyl-3a,4,7,7a-tetrahydro-1,3-benzoxazole-3-carboxylate |
| SMILES | CCOC(=O)N1[C@H]2[C@H](CC=C[C@@H]2O)OC1(C)C |
| InChI | InChI=1S/C12H19NO4/c1-4-16-11(15)13-10-8(14)6-5-7-9(10)17-12(13,2)3/h5-6,8-10,14H,4,7H2,1-3H3/t8-,9-,10+/m0/s1 |
| InChIKey | PFODNWMZTBPMQI-LPEHRKFASA-N |
| XLogP | 1.27 |
| TPSA | 59.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 241.29 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|