C23H19NO5 — CID 108576467
3-(furan-2-carbonyl)-4-hydroxy-2-(4-methoxyphenyl)-1-(2-methylphenyl)-2H-pyrrol-5-one (PubChem CID 108576467) has the molecular formula C23H19NO5 and a molecular weight of 389.41 g/mol. Its IUPAC name is 3-(furan-2-carbonyl)-4-hydroxy-2-(4-methoxyphenyl)-1-(2-methylphenyl)-2H-pyrrol-5-one.
| Compound Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(4-methoxyphenyl)-1-(2-methylphenyl)-2H-pyrrol-5-one |
|---|---|
| PubChem CID | 108576467 |
| Molecular Formula | C23H19NO5 |
| Molecular Weight | 389.41 g/mol |
| Exact Mass | 389.13 |
| IUPAC Name | 3-(furan-2-carbonyl)-4-hydroxy-2-(4-methoxyphenyl)-1-(2-methylphenyl)-2H-pyrrol-5-one |
| SMILES | COc1ccc(C2C(C(=O)c3ccco3)=C(O)C(=O)N2c2ccccc2C)cc1 |
| InChI | InChI=1S/C23H19NO5/c1-14-6-3-4-7-17(14)24-20(15-9-11-16(28-2)12-10-15)19(22(26)23(24)27)21(25)18-8-5-13-29-18/h3-13,20,26H,1-2H3 |
| InChIKey | ASXNTRAQZGLIIZ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 79.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.41 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |