About hexan-2-yl benzenesulfonate
hexan-2-yl benzenesulfonate (PubChem CID 10857660) has the molecular formula C12H18O3S
and a molecular weight of 242.34 g/mol. Its IUPAC name is hexan-2-yl benzenesulfonate.
Molecular Properties
| Compound Name | hexan-2-yl benzenesulfonate |
| PubChem CID | 10857660 |
| Molecular Formula | C12H18O3S |
| Molecular Weight | 242.34 g/mol |
| Exact Mass | 242.10 |
| IUPAC Name | hexan-2-yl benzenesulfonate |
| SMILES | CCCCC(C)OS(=O)(=O)c1ccccc1 |
| InChI | InChI=1S/C12H18O3S/c1-3-4-8-11(2)15-16(13,14)12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3 |
| InChIKey | WDLBCEWYFHOSAX-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.34 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|
Analyze hexan-2-yl benzenesulfonate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexan-2-yl benzenesulfonate?
The IUPAC name of hexan-2-yl benzenesulfonate (CID 10857660) is hexan-2-yl benzenesulfonate.
What is the SMILES notation for hexan-2-yl benzenesulfonate?
The canonical SMILES for hexan-2-yl benzenesulfonate is CCCCC(C)OS(=O)(=O)c1ccccc1.
What is the InChIKey of hexan-2-yl benzenesulfonate?
The InChIKey is WDLBCEWYFHOSAX-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18O3S/c1-3-4-8-11(2)15-16(13,14)12-9-6-5-7-10-12/h5-7,9-11H,3-4,8H2,1-2H3.
What are the key properties of hexan-2-yl benzenesulfonate?
hexan-2-yl benzenesulfonate has a molecular weight of 242.34 g/mol, XLogP of 2.97, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for hexan-2-yl benzenesulfonate is sourced from PubChem (CID 10857660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).