C12H24O3Si — CID 10857727
(5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-one (PubChem CID 10857727) has the molecular formula C12H24O3Si and a molecular weight of 244.41 g/mol. Its IUPAC name is (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-one.
| Compound Name | (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-one |
|---|---|
| PubChem CID | 10857727 |
| Molecular Formula | C12H24O3Si |
| Molecular Weight | 244.41 g/mol |
| Exact Mass | 244.15 |
| IUPAC Name | (5R,6S)-5-[tert-butyl(dimethyl)silyl]oxy-6-methyloxan-2-one |
| SMILES | C[C@@H]1OC(=O)CC[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H24O3Si/c1-9-10(7-8-11(13)14-9)15-16(5,6)12(2,3)4/h9-10H,7-8H2,1-6H3/t9-,10+/m0/s1 |
| InChIKey | KJJTXDOJMABXED-VHSXEESVSA-N |
| XLogP | 3.10 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.41 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|