C16H24O2 — CID 10857831
(2S,3S,4E)-2,3-dimethyl-4-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]butanoic acid (PubChem CID 10857831) has the molecular formula C16H24O2 and a molecular weight of 248.37 g/mol. Its IUPAC name is (2S,3S,4E)-2,3-dimethyl-4-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]butanoic acid.
| Compound Name | (2S,3S,4E)-2,3-dimethyl-4-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]butanoic acid |
|---|---|
| PubChem CID | 10857831 |
| Molecular Formula | C16H24O2 |
| Molecular Weight | 248.37 g/mol |
| Exact Mass | 248.18 |
| IUPAC Name | (2S,3S,4E)-2,3-dimethyl-4-[(5R)-2-methyl-5-prop-1-en-2-ylcyclohex-2-en-1-ylidene]butanoic acid |
| SMILES | C=C(C)[C@@H]1CC=C(C)/C(=C/[C@H](C)[C@H](C)C(=O)O)C1 |
| InChI | InChI=1S/C16H24O2/c1-10(2)14-7-6-11(3)15(9-14)8-12(4)13(5)16(17)18/h6,8,12-14H,1,7,9H2,2-5H3,(H,17,18)/b15-8+/t12-,13-,14+/m0/s1 |
| InChIKey | PKPQNRRITUKNPA-ALPGRGJNSA-N |
| XLogP | 4.20 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 248.37 |
| LogP ≤ 5 | 4.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|