C13H18O5 — CID 10858009
(1S,2R,6S,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxatricyclo[8.3.0.02,6]tridec-8-en-7-one (PubChem CID 10858009) has the molecular formula C13H18O5 and a molecular weight of 254.28 g/mol. Its IUPAC name is (1S,2R,6S,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxatricyclo[8.3.0.02,6]tridec-8-en-7-one.
| Compound Name | (1S,2R,6S,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxatricyclo[8.3.0.02,6]tridec-8-en-7-one |
|---|---|
| PubChem CID | 10858009 |
| Molecular Formula | C13H18O5 |
| Molecular Weight | 254.28 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | (1S,2R,6S,10S)-4,4,12,12-tetramethyl-3,5,11,13-tetraoxatricyclo[8.3.0.02,6]tridec-8-en-7-one |
| SMILES | CC1(C)O[C@@H]2[C@H]3OC(C)(C)O[C@@H]3C(=O)C=C[C@@H]2O1 |
| InChI | InChI=1S/C13H18O5/c1-12(2)15-8-6-5-7(14)9-11(10(8)17-12)18-13(3,4)16-9/h5-6,8-11H,1-4H3/t8-,9+,10-,11-/m0/s1 |
| InChIKey | JJISMLIHVKKEPT-VLEAKVRGSA-N |
| XLogP | 1.17 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.28 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |