C26H23BrN2O3 — CID 108580901
(4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(3-methylphenyl)pyrrolidine-2,3-dione (PubChem CID 108580901) has the molecular formula C26H23BrN2O3 and a molecular weight of 491.39 g/mol. Its IUPAC name is (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(3-methylphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(3-methylphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108580901 |
| Molecular Formula | C26H23BrN2O3 |
| Molecular Weight | 491.39 g/mol |
| Exact Mass | 490.09 |
| IUPAC Name | (4E)-4-[(4-bromophenyl)-hydroxymethylidene]-5-[4-(dimethylamino)phenyl]-1-(3-methylphenyl)pyrrolidine-2,3-dione |
| SMILES | Cc1cccc(N2C(=O)C(=O)/C(=C(/O)c3ccc(Br)cc3)C2c2ccc(N(C)C)cc2)c1 |
| InChI | InChI=1S/C26H23BrN2O3/c1-16-5-4-6-21(15-16)29-23(17-9-13-20(14-10-17)28(2)3)22(25(31)26(29)32)24(30)18-7-11-19(27)12-8-18/h4-15,23,30H,1-3H3/b24-22+ |
| InChIKey | AOAXUUQISQGWJO-ZNTNEXAZSA-N |
| XLogP | 5.45 |
| TPSA | 60.85 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 491.39 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|