C12H22O4Si — CID 10858168
(1R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-oxabicyclo[2.2.1]heptan-3-one (PubChem CID 10858168) has the molecular formula C12H22O4Si and a molecular weight of 258.39 g/mol. Its IUPAC name is (1R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-oxabicyclo[2.2.1]heptan-3-one.
| Compound Name | (1R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-oxabicyclo[2.2.1]heptan-3-one |
|---|---|
| PubChem CID | 10858168 |
| Molecular Formula | C12H22O4Si |
| Molecular Weight | 258.39 g/mol |
| Exact Mass | 258.13 |
| IUPAC Name | (1R,4S,5R,6R)-6-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-oxabicyclo[2.2.1]heptan-3-one |
| SMILES | CC(C)(C)[Si](C)(C)O[C@@H]1[C@H](O)[C@@H]2C[C@H]1OC2=O |
| InChI | InChI=1S/C12H22O4Si/c1-12(2,3)17(4,5)16-10-8-6-7(9(10)13)11(14)15-8/h7-10,13H,6H2,1-5H3/t7-,8+,9+,10-/m0/s1 |
| InChIKey | ZYBSMFKNFLEYTK-JLIMGVALSA-N |
| XLogP | 1.68 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.39 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|