C19H19Cl2N5O2 — CID 1085818
(5R,7R)-5-(3,4-dichlorophenyl)-7-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine (PubChem CID 1085818) has the molecular formula C19H19Cl2N5O2 and a molecular weight of 420.30 g/mol. Its IUPAC name is (5R,7R)-5-(3,4-dichlorophenyl)-7-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine.
| Compound Name | (5R,7R)-5-(3,4-dichlorophenyl)-7-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
|---|---|
| PubChem CID | 1085818 |
| Molecular Formula | C19H19Cl2N5O2 |
| Molecular Weight | 420.30 g/mol |
| Exact Mass | 419.09 |
| IUPAC Name | (5R,7R)-5-(3,4-dichlorophenyl)-7-(3,4-dimethoxyphenyl)-4,5,6,7-tetrahydro-[1,2,4]triazolo[1,5-a]pyrimidin-2-amine |
| SMILES | COc1ccc([C@H]2C[C@H](c3ccc(Cl)c(Cl)c3)Nc3nc(N)nn32)cc1OC |
| InChI | InChI=1S/C19H19Cl2N5O2/c1-27-16-6-4-11(8-17(16)28-2)15-9-14(10-3-5-12(20)13(21)7-10)23-19-24-18(22)25-26(15)19/h3-8,14-15H,9H2,1-2H3,(H3,22,23,24,25)/t14-,15-/m1/s1 |
| InChIKey | AZOHHCFABHHULM-HUUCEWRRSA-N |
| XLogP | 4.33 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.30 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |