C29H29NO6 — CID 108582398
(4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2,5-dimethylphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione (PubChem CID 108582398) has the molecular formula C29H29NO6 and a molecular weight of 487.55 g/mol. Its IUPAC name is (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2,5-dimethylphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione.
| Compound Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2,5-dimethylphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
|---|---|
| PubChem CID | 108582398 |
| Molecular Formula | C29H29NO6 |
| Molecular Weight | 487.55 g/mol |
| Exact Mass | 487.20 |
| IUPAC Name | (4Z)-4-[(2,4-diethoxyphenyl)-hydroxymethylidene]-1-(2,5-dimethylphenyl)-5-(4-hydroxyphenyl)pyrrolidine-2,3-dione |
| SMILES | CCOc1ccc(/C(O)=C2/C(=O)C(=O)N(c3cc(C)ccc3C)C2c2ccc(O)cc2)c(OCC)c1 |
| InChI | InChI=1S/C29H29NO6/c1-5-35-21-13-14-22(24(16-21)36-6-2)27(32)25-26(19-9-11-20(31)12-10-19)30(29(34)28(25)33)23-15-17(3)7-8-18(23)4/h7-16,26,31-32H,5-6H2,1-4H3/b27-25- |
| InChIKey | DILJKKCCKNFBKV-RFBIWTDZSA-N |
| XLogP | 5.43 |
| TPSA | 96.30 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.55 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|